C13H18F4N4O — CID 75510031
4-ethoxy-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine (PubChem CID 75510031) has the molecular formula C13H18F4N4O and a molecular weight of 322.31 g/mol. Its IUPAC name is 4-ethoxy-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-ethoxy-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 75510031 |
| Molecular Formula | C13H18F4N4O |
| Molecular Weight | 322.31 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | 4-ethoxy-6-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine |
| SMILES | CCOc1cc(N2CCN(CC(F)(F)C(F)F)CC2)ncn1 |
| InChI | InChI=1S/C13H18F4N4O/c1-2-22-11-7-10(18-9-19-11)21-5-3-20(4-6-21)8-13(16,17)12(14)15/h7,9,12H,2-6,8H2,1H3 |
| InChIKey | MKARZLAPXVDSPF-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 41.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.31 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|