C12H16F4N4 — CID 133304383
4-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine (PubChem CID 133304383) has the molecular formula C12H16F4N4 and a molecular weight of 292.28 g/mol. Its IUPAC name is 4-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine.
| Compound Name | 4-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine |
|---|---|
| PubChem CID | 133304383 |
| Molecular Formula | C12H16F4N4 |
| Molecular Weight | 292.28 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 4-methyl-2-[4-(2,2,3,3-tetrafluoropropyl)piperazin-1-yl]pyrimidine |
| SMILES | Cc1ccnc(N2CCN(CC(F)(F)C(F)F)CC2)n1 |
| InChI | InChI=1S/C12H16F4N4/c1-9-2-3-17-11(18-9)20-6-4-19(5-7-20)8-12(15,16)10(13)14/h2-3,10H,4-8H2,1H3 |
| InChIKey | KRKJPIAUXRRFJS-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.28 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|