C14H13F3N2OS — CID 133488469
2-(2-thiophen-2-ylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine (PubChem CID 133488469) has the molecular formula C14H13F3N2OS and a molecular weight of 314.33 g/mol. Its IUPAC name is 2-(2-thiophen-2-ylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine.
| Compound Name | 2-(2-thiophen-2-ylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine |
|---|---|
| PubChem CID | 133488469 |
| Molecular Formula | C14H13F3N2OS |
| Molecular Weight | 314.33 g/mol |
| Exact Mass | 314.07 |
| IUPAC Name | 2-(2-thiophen-2-ylpyrrolidin-1-yl)-5-(trifluoromethoxy)pyridine |
| SMILES | FC(F)(F)Oc1ccc(N2CCCC2c2cccs2)nc1 |
| InChI | InChI=1S/C14H13F3N2OS/c15-14(16,17)20-10-5-6-13(18-9-10)19-7-1-3-11(19)12-4-2-8-21-12/h2,4-6,8-9,11H,1,3,7H2 |
| InChIKey | ZURHABXNNBKOCV-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.33 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |