C20H23N5OS2 — CID 124865996
2-methoxy-4,6-bis[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-1,3,5-triazine (PubChem CID 124865996) has the molecular formula C20H23N5OS2 and a molecular weight of 413.57 g/mol. Its IUPAC name is 2-methoxy-4,6-bis[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-1,3,5-triazine.
| Compound Name | 2-methoxy-4,6-bis[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-1,3,5-triazine |
|---|---|
| PubChem CID | 124865996 |
| Molecular Formula | C20H23N5OS2 |
| Molecular Weight | 413.57 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 2-methoxy-4,6-bis[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-1,3,5-triazine |
| SMILES | COc1nc(N2CCC[C@H]2c2cccs2)nc(N2CCC[C@H]2c2cccs2)n1 |
| InChI | InChI=1S/C20H23N5OS2/c1-26-20-22-18(24-10-2-6-14(24)16-8-4-12-27-16)21-19(23-20)25-11-3-7-15(25)17-9-5-13-28-17/h4-5,8-9,12-15H,2-3,6-7,10-11H2,1H3/t14-,15-/m0/s1 |
| InChIKey | KBRXTAJMGGQRHL-GJZGRUSLSA-N |
| XLogP | 4.69 |
| TPSA | 54.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |