C13H12F3N3S — CID 97012968
2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 97012968) has the molecular formula C13H12F3N3S and a molecular weight of 299.32 g/mol. Its IUPAC name is 2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 97012968 |
| Molecular Formula | C13H12F3N3S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 2-[(2S)-2-thiophen-2-ylpyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | FC(F)(F)c1ccnc(N2CCC[C@H]2c2cccs2)n1 |
| InChI | InChI=1S/C13H12F3N3S/c14-13(15,16)11-5-6-17-12(18-11)19-7-1-3-9(19)10-4-2-8-20-10/h2,4-6,8-9H,1,3,7H2/t9-/m0/s1 |
| InChIKey | FNMUQLBESMWBIU-VIFPVBQESA-N |
| XLogP | 3.90 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |