C14H19F3N4 — CID 64585888
N-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-2-yl]methyl]cyclopropanamine (PubChem CID 64585888) has the molecular formula C14H19F3N4 and a molecular weight of 300.33 g/mol. Its IUPAC name is N-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-2-yl]methyl]cyclopropanamine.
| Compound Name | N-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-2-yl]methyl]cyclopropanamine |
|---|---|
| PubChem CID | 64585888 |
| Molecular Formula | C14H19F3N4 |
| Molecular Weight | 300.33 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | N-[[1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-2-yl]methyl]cyclopropanamine |
| SMILES | FC(F)(F)c1ccnc(N2CCCCC2CNC2CC2)n1 |
| InChI | InChI=1S/C14H19F3N4/c15-14(16,17)12-6-7-18-13(20-12)21-8-2-1-3-11(21)9-19-10-4-5-10/h6-7,10-11,19H,1-5,8-9H2 |
| InChIKey | WABZFMMMBVKIDJ-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.33 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |