C9H10F3N3 — CID 166068939
2-[(2S)-2-methylazetidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 166068939) has the molecular formula C9H10F3N3 and a molecular weight of 217.19 g/mol. Its IUPAC name is 2-[(2S)-2-methylazetidin-1-yl]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[(2S)-2-methylazetidin-1-yl]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 166068939 |
| Molecular Formula | C9H10F3N3 |
| Molecular Weight | 217.19 g/mol |
| Exact Mass | 217.08 |
| IUPAC Name | 2-[(2S)-2-methylazetidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | C[C@H]1CCN1c1nccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C9H10F3N3/c1-6-3-5-15(6)8-13-4-2-7(14-8)9(10,11)12/h2,4,6H,3,5H2,1H3/t6-/m0/s1 |
| InChIKey | UWXZPGKVCIJLNY-LURJTMIESA-N |
| XLogP | 2.09 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.19 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |