C12H16F3N3S — CID 124590786
(3S)-3-methylsulfanyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]azepane (PubChem CID 124590786) has the molecular formula C12H16F3N3S and a molecular weight of 291.34 g/mol. Its IUPAC name is (3S)-3-methylsulfanyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]azepane.
| Compound Name | (3S)-3-methylsulfanyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]azepane |
|---|---|
| PubChem CID | 124590786 |
| Molecular Formula | C12H16F3N3S |
| Molecular Weight | 291.34 g/mol |
| Exact Mass | 291.10 |
| IUPAC Name | (3S)-3-methylsulfanyl-1-[4-(trifluoromethyl)pyrimidin-2-yl]azepane |
| SMILES | CS[C@H]1CCCCN(c2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C12H16F3N3S/c1-19-9-4-2-3-7-18(8-9)11-16-6-5-10(17-11)12(13,14)15/h5-6,9H,2-4,7-8H2,1H3/t9-/m0/s1 |
| InChIKey | PFSJGABYYXFFKN-VIFPVBQESA-N |
| XLogP | 3.22 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.34 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |