C15H22F3N5 — CID 133292848
2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine (PubChem CID 133292848) has the molecular formula C15H22F3N5 and a molecular weight of 329.37 g/mol. Its IUPAC name is 2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine.
| Compound Name | 2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine |
|---|---|
| PubChem CID | 133292848 |
| Molecular Formula | C15H22F3N5 |
| Molecular Weight | 329.37 g/mol |
| Exact Mass | 329.18 |
| IUPAC Name | 2-[3-(4-ethylpiperazin-1-yl)pyrrolidin-1-yl]-4-(trifluoromethyl)pyrimidine |
| SMILES | CCN1CCN(C2CCN(c3nccc(C(F)(F)F)n3)C2)CC1 |
| InChI | InChI=1S/C15H22F3N5/c1-2-21-7-9-22(10-8-21)12-4-6-23(11-12)14-19-5-3-13(20-14)15(16,17)18/h3,5,12H,2,4,6-11H2,1H3 |
| InChIKey | MVBLBWFUFGQXKV-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.37 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |