C11H15Cl3N4 — CID 70394813
2-(4-ethylpiperazin-1-yl)-4-(trichloromethyl)pyrimidine (PubChem CID 70394813) has the molecular formula C11H15Cl3N4 and a molecular weight of 309.63 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-4-(trichloromethyl)pyrimidine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-4-(trichloromethyl)pyrimidine |
|---|---|
| PubChem CID | 70394813 |
| Molecular Formula | C11H15Cl3N4 |
| Molecular Weight | 309.63 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-4-(trichloromethyl)pyrimidine |
| SMILES | CCN1CCN(c2nccc(C(Cl)(Cl)Cl)n2)CC1 |
| InChI | InChI=1S/C11H15Cl3N4/c1-2-17-5-7-18(8-6-17)10-15-4-3-9(16-10)11(12,13)14/h3-4H,2,5-8H2,1H3 |
| InChIKey | QVLOMODCNGIKKS-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.63 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|