C12H21N5 — CID 133365840
2-(4-ethylpiperazin-1-yl)-N,N-dimethylpyrimidin-4-amine (PubChem CID 133365840) has the molecular formula C12H21N5 and a molecular weight of 235.33 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-N,N-dimethylpyrimidin-4-amine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-N,N-dimethylpyrimidin-4-amine |
|---|---|
| PubChem CID | 133365840 |
| Molecular Formula | C12H21N5 |
| Molecular Weight | 235.33 g/mol |
| Exact Mass | 235.18 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-N,N-dimethylpyrimidin-4-amine |
| SMILES | CCN1CCN(c2nccc(N(C)C)n2)CC1 |
| InChI | InChI=1S/C12H21N5/c1-4-16-7-9-17(10-8-16)12-13-6-5-11(14-12)15(2)3/h5-6H,4,7-10H2,1-3H3 |
| InChIKey | RNPXDDDNBBADCV-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.33 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |