C16H27N5 — CID 112885063
2-(4-ethylpiperazin-1-yl)-4-(4-methylpiperidin-1-yl)pyrimidine (PubChem CID 112885063) has the molecular formula C16H27N5 and a molecular weight of 289.43 g/mol. Its IUPAC name is 2-(4-ethylpiperazin-1-yl)-4-(4-methylpiperidin-1-yl)pyrimidine.
| Compound Name | 2-(4-ethylpiperazin-1-yl)-4-(4-methylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 112885063 |
| Molecular Formula | C16H27N5 |
| Molecular Weight | 289.43 g/mol |
| Exact Mass | 289.23 |
| IUPAC Name | 2-(4-ethylpiperazin-1-yl)-4-(4-methylpiperidin-1-yl)pyrimidine |
| SMILES | CCN1CCN(c2nccc(N3CCC(C)CC3)n2)CC1 |
| InChI | InChI=1S/C16H27N5/c1-3-19-10-12-21(13-11-19)16-17-7-4-15(18-16)20-8-5-14(2)6-9-20/h4,7,14H,3,5-6,8-13H2,1-2H3 |
| InChIKey | AWOBEKVLZFHJAA-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 35.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.43 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |