C10H14ClN3 — CID 130067368
4-chloro-2-(4-methylpiperidin-1-yl)pyrimidine (PubChem CID 130067368) has the molecular formula C10H14ClN3 and a molecular weight of 211.70 g/mol. Its IUPAC name is 4-chloro-2-(4-methylpiperidin-1-yl)pyrimidine.
| Compound Name | 4-chloro-2-(4-methylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 130067368 |
| Molecular Formula | C10H14ClN3 |
| Molecular Weight | 211.70 g/mol |
| Exact Mass | 211.09 |
| IUPAC Name | 4-chloro-2-(4-methylpiperidin-1-yl)pyrimidine |
| SMILES | CC1CCN(c2nccc(Cl)n2)CC1 |
| InChI | InChI=1S/C10H14ClN3/c1-8-3-6-14(7-4-8)10-12-5-2-9(11)13-10/h2,5,8H,3-4,6-7H2,1H3 |
| InChIKey | PUTARSLASXCPGC-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.70 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |