C10H18N4 — CID 70283358
azane;2-(4-methylpiperidin-1-yl)pyrimidine (PubChem CID 70283358) has the molecular formula C10H18N4 and a molecular weight of 194.28 g/mol. Its IUPAC name is azane;2-(4-methylpiperidin-1-yl)pyrimidine.
| Compound Name | azane;2-(4-methylpiperidin-1-yl)pyrimidine |
|---|---|
| PubChem CID | 70283358 |
| Molecular Formula | C10H18N4 |
| Molecular Weight | 194.28 g/mol |
| Exact Mass | 194.15 |
| IUPAC Name | azane;2-(4-methylpiperidin-1-yl)pyrimidine |
| SMILES | CC1CCN(c2ncccn2)CC1.N |
| InChI | InChI=1S/C10H15N3.H3N/c1-9-3-7-13(8-4-9)10-11-5-2-6-12-10;/h2,5-6,9H,3-4,7-8H2,1H3;1H3 |
| InChIKey | VQFFAAWSERCKNJ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 64.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |