C16H15F3N4O — CID 97153254
pyridin-3-yl-[(3S)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-3-yl]methanone (PubChem CID 97153254) has the molecular formula C16H15F3N4O and a molecular weight of 336.32 g/mol. Its IUPAC name is pyridin-3-yl-[(3S)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-3-yl]methanone.
| Compound Name | pyridin-3-yl-[(3S)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 97153254 |
| Molecular Formula | C16H15F3N4O |
| Molecular Weight | 336.32 g/mol |
| Exact Mass | 336.12 |
| IUPAC Name | pyridin-3-yl-[(3S)-1-[4-(trifluoromethyl)pyrimidin-2-yl]piperidin-3-yl]methanone |
| SMILES | O=C(c1cccnc1)[C@H]1CCCN(c2nccc(C(F)(F)F)n2)C1 |
| InChI | InChI=1S/C16H15F3N4O/c17-16(18,19)13-5-7-21-15(22-13)23-8-2-4-12(10-23)14(24)11-3-1-6-20-9-11/h1,3,5-7,9,12H,2,4,8,10H2/t12-/m0/s1 |
| InChIKey | YQGDJOTZWKGXDJ-LBPRGKRZSA-N |
| XLogP | 2.99 |
| TPSA | 58.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.32 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |