C14H17F3N4O2 — CID 165434652
morpholin-4-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanone (PubChem CID 165434652) has the molecular formula C14H17F3N4O2 and a molecular weight of 330.31 g/mol. Its IUPAC name is morpholin-4-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanone |
|---|---|
| PubChem CID | 165434652 |
| Molecular Formula | C14H17F3N4O2 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | morpholin-4-yl-[1-[4-(trifluoromethyl)pyrimidin-2-yl]pyrrolidin-3-yl]methanone |
| SMILES | O=C(C1CCN(c2nccc(C(F)(F)F)n2)C1)N1CCOCC1 |
| InChI | InChI=1S/C14H17F3N4O2/c15-14(16,17)11-1-3-18-13(19-11)21-4-2-10(9-21)12(22)20-5-7-23-8-6-20/h1,3,10H,2,4-9H2 |
| InChIKey | OYINTVJRTUGGJE-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |