C20H31N5O2 — CID 56864340
[1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 56864340) has the molecular formula C20H31N5O2 and a molecular weight of 373.50 g/mol. Its IUPAC name is [1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 56864340 |
| Molecular Formula | C20H31N5O2 |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.25 |
| IUPAC Name | [1-[1-(4-methylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | Cc1ccnc(N2CCC(N3CCCC(C(=O)N4CCOCC4)C3)CC2)n1 |
| InChI | InChI=1S/C20H31N5O2/c1-16-4-7-21-20(22-16)24-9-5-18(6-10-24)25-8-2-3-17(15-25)19(26)23-11-13-27-14-12-23/h4,7,17-18H,2-3,5-6,8-15H2,1H3 |
| InChIKey | NASSFFFKAJTYBU-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |