C21H31N5O3 — CID 95524873
2-[4-[(3S)-3-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]pyridine-4-carboxamide (PubChem CID 95524873) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is 2-[4-[(3S)-3-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]pyridine-4-carboxamide.
| Compound Name | 2-[4-[(3S)-3-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 95524873 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | 2-[4-[(3S)-3-(morpholine-4-carbonyl)piperidin-1-yl]piperidin-1-yl]pyridine-4-carboxamide |
| SMILES | NC(=O)c1ccnc(N2CCC(N3CCC[C@H](C(=O)N4CCOCC4)C3)CC2)c1 |
| InChI | InChI=1S/C21H31N5O3/c22-20(27)16-3-6-23-19(14-16)24-8-4-18(5-9-24)26-7-1-2-17(15-26)21(28)25-10-12-29-13-11-25/h3,6,14,17-18H,1-2,4-5,7-13,15H2,(H2,22,27)/t17-/m0/s1 |
| InChIKey | VGUWFTCVHVEDMY-KRWDZBQOSA-N |
| XLogP | 0.72 |
| TPSA | 92.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |