C21H33N5O2 — CID 95463751
[(3R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 95463751) has the molecular formula C21H33N5O2 and a molecular weight of 387.53 g/mol. Its IUPAC name is [(3R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [(3R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 95463751 |
| Molecular Formula | C21H33N5O2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.26 |
| IUPAC Name | [(3R)-1-[1-(5-ethylpyrimidin-2-yl)piperidin-4-yl]piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | CCc1cnc(N2CCC(N3CCC[C@@H](C(=O)N4CCOCC4)C3)CC2)nc1 |
| InChI | InChI=1S/C21H33N5O2/c1-2-17-14-22-21(23-15-17)25-8-5-19(6-9-25)26-7-3-4-18(16-26)20(27)24-10-12-28-13-11-24/h14-15,18-19H,2-13,16H2,1H3/t18-/m1/s1 |
| InChIKey | RXPWBDYDZQAJRT-GOSISDBHSA-N |
| XLogP | 1.58 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |