C17H20F3N7O — CID 97239113
[(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone (PubChem CID 97239113) has the molecular formula C17H20F3N7O and a molecular weight of 395.39 g/mol. Its IUPAC name is [(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone.
| Compound Name | [(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 97239113 |
| Molecular Formula | C17H20F3N7O |
| Molecular Weight | 395.39 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | [(6S)-3-methyl-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyridin-6-yl]-[4-[4-(trifluoromethyl)pyrimidin-2-yl]piperazin-1-yl]methanone |
| SMILES | Cc1nnc2n1C[C@@H](C(=O)N1CCN(c3nccc(C(F)(F)F)n3)CC1)CC2 |
| InChI | InChI=1S/C17H20F3N7O/c1-11-23-24-14-3-2-12(10-27(11)14)15(28)25-6-8-26(9-7-25)16-21-5-4-13(22-16)17(18,19)20/h4-5,12H,2-3,6-10H2,1H3/t12-/m0/s1 |
| InChIKey | PDSLIPAJTSYYLQ-LBPRGKRZSA-N |
| XLogP | 1.31 |
| TPSA | 80.04 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.39 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |