C19H23N5O2 — CID 72847566
morpholin-4-yl-[1-(4-pyridin-3-ylpyrimidin-2-yl)piperidin-3-yl]methanone (PubChem CID 72847566) has the molecular formula C19H23N5O2 and a molecular weight of 353.43 g/mol. Its IUPAC name is morpholin-4-yl-[1-(4-pyridin-3-ylpyrimidin-2-yl)piperidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-(4-pyridin-3-ylpyrimidin-2-yl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 72847566 |
| Molecular Formula | C19H23N5O2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.19 |
| IUPAC Name | morpholin-4-yl-[1-(4-pyridin-3-ylpyrimidin-2-yl)piperidin-3-yl]methanone |
| SMILES | O=C(C1CCCN(c2nccc(-c3cccnc3)n2)C1)N1CCOCC1 |
| InChI | InChI=1S/C19H23N5O2/c25-18(23-9-11-26-12-10-23)16-4-2-8-24(14-16)19-21-7-5-17(22-19)15-3-1-6-20-13-15/h1,3,5-7,13,16H,2,4,8-12,14H2 |
| InChIKey | QGXNIUMUSOWFLL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 71.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |