C15H22N4O2S — CID 155975861
[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone (PubChem CID 155975861) has the molecular formula C15H22N4O2S and a molecular weight of 322.43 g/mol. Its IUPAC name is [1-(2-methylsulfanylpyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone.
| Compound Name | [1-(2-methylsulfanylpyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone |
|---|---|
| PubChem CID | 155975861 |
| Molecular Formula | C15H22N4O2S |
| Molecular Weight | 322.43 g/mol |
| Exact Mass | 322.15 |
| IUPAC Name | [1-(2-methylsulfanylpyrimidin-4-yl)piperidin-3-yl]-morpholin-4-ylmethanone |
| SMILES | CSc1nccc(N2CCCC(C(=O)N3CCOCC3)C2)n1 |
| InChI | InChI=1S/C15H22N4O2S/c1-22-15-16-5-4-13(17-15)19-6-2-3-12(11-19)14(20)18-7-9-21-10-8-18/h4-5,12H,2-3,6-11H2,1H3 |
| InChIKey | YUUFJXAFIJCNPN-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.43 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |