C10H15N3O2S — CID 70750135
4-(2-methylsulfanylpyrimidin-4-yl)-1,4-oxazepan-6-ol (PubChem CID 70750135) has the molecular formula C10H15N3O2S and a molecular weight of 241.32 g/mol. Its IUPAC name is 4-(2-methylsulfanylpyrimidin-4-yl)-1,4-oxazepan-6-ol.
| Compound Name | 4-(2-methylsulfanylpyrimidin-4-yl)-1,4-oxazepan-6-ol |
|---|---|
| PubChem CID | 70750135 |
| Molecular Formula | C10H15N3O2S |
| Molecular Weight | 241.32 g/mol |
| Exact Mass | 241.09 |
| IUPAC Name | 4-(2-methylsulfanylpyrimidin-4-yl)-1,4-oxazepan-6-ol |
| SMILES | CSc1nccc(N2CCOCC(O)C2)n1 |
| InChI | InChI=1S/C10H15N3O2S/c1-16-10-11-3-2-9(12-10)13-4-5-15-7-8(14)6-13/h2-3,8,14H,4-7H2,1H3 |
| InChIKey | WRAZVSKPMRWKGK-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 58.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.32 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |