C15H22N4OS — CID 171328377
N-methyl-N-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]cyclopropanecarboxamide (PubChem CID 171328377) has the molecular formula C15H22N4OS and a molecular weight of 306.43 g/mol. Its IUPAC name is N-methyl-N-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]cyclopropanecarboxamide.
| Compound Name | N-methyl-N-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 171328377 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.43 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | N-methyl-N-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]cyclopropanecarboxamide |
| SMILES | CSc1nccc(N2CCC(N(C)C(=O)C3CC3)CC2)n1 |
| InChI | InChI=1S/C15H22N4OS/c1-18(14(20)11-3-4-11)12-6-9-19(10-7-12)13-5-8-16-15(17-13)21-2/h5,8,11-12H,3-4,6-7,9-10H2,1-2H3 |
| InChIKey | YWKLLSVPNKEFKA-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 49.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.43 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |