C20H32N4O2S — CID 24958508
tert-butyl 4-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 24958508) has the molecular formula C20H32N4O2S and a molecular weight of 392.57 g/mol. Its IUPAC name is tert-butyl 4-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 24958508 |
| Molecular Formula | C20H32N4O2S |
| Molecular Weight | 392.57 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | tert-butyl 4-[1-(2-methylsulfanylpyrimidin-4-yl)piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CSc1nccc(N2CCC(C3CCN(C(=O)OC(C)(C)C)CC3)CC2)n1 |
| InChI | InChI=1S/C20H32N4O2S/c1-20(2,3)26-19(25)24-13-8-16(9-14-24)15-6-11-23(12-7-15)17-5-10-21-18(22-17)27-4/h5,10,15-16H,6-9,11-14H2,1-4H3 |
| InChIKey | BMFLDJZYNILCTP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 58.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.57 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |