C20H33N5O2 — CID 59178932
tert-butyl 4-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]piperidine-1-carboxylate (PubChem CID 59178932) has the molecular formula C20H33N5O2 and a molecular weight of 375.52 g/mol. Its IUPAC name is tert-butyl 4-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 59178932 |
| Molecular Formula | C20H33N5O2 |
| Molecular Weight | 375.52 g/mol |
| Exact Mass | 375.26 |
| IUPAC Name | tert-butyl 4-[1-[2-(methylamino)pyrimidin-4-yl]piperidin-4-yl]piperidine-1-carboxylate |
| SMILES | CNc1nccc(N2CCC(C3CCN(C(=O)OC(C)(C)C)CC3)CC2)n1 |
| InChI | InChI=1S/C20H33N5O2/c1-20(2,3)27-19(26)25-13-8-16(9-14-25)15-6-11-24(12-7-15)17-5-10-22-18(21-4)23-17/h5,10,15-16H,6-9,11-14H2,1-4H3,(H,21,22,23) |
| InChIKey | LNUNEXNAZXLPJQ-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.52 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |