C17H25N3O3S — CID 21036756
tert-butyl 4-[2-(2-methylsulfanylpyrimidin-4-yl)acetyl]piperidine-1-carboxylate (PubChem CID 21036756) has the molecular formula C17H25N3O3S and a molecular weight of 351.47 g/mol. Its IUPAC name is tert-butyl 4-[2-(2-methylsulfanylpyrimidin-4-yl)acetyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-(2-methylsulfanylpyrimidin-4-yl)acetyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 21036756 |
| Molecular Formula | C17H25N3O3S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | tert-butyl 4-[2-(2-methylsulfanylpyrimidin-4-yl)acetyl]piperidine-1-carboxylate |
| SMILES | CSc1nccc(CC(=O)C2CCN(C(=O)OC(C)(C)C)CC2)n1 |
| InChI | InChI=1S/C17H25N3O3S/c1-17(2,3)23-16(22)20-9-6-12(7-10-20)14(21)11-13-5-8-18-15(19-13)24-4/h5,8,12H,6-7,9-11H2,1-4H3 |
| InChIKey | UPTJYUMJXBDTLS-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |