C19H27N3O4 — CID 139271621
tert-butyl 4-[2-[(2-pyridin-2-ylacetyl)amino]acetyl]piperidine-1-carboxylate (PubChem CID 139271621) has the molecular formula C19H27N3O4 and a molecular weight of 361.44 g/mol. Its IUPAC name is tert-butyl 4-[2-[(2-pyridin-2-ylacetyl)amino]acetyl]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[2-[(2-pyridin-2-ylacetyl)amino]acetyl]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 139271621 |
| Molecular Formula | C19H27N3O4 |
| Molecular Weight | 361.44 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | tert-butyl 4-[2-[(2-pyridin-2-ylacetyl)amino]acetyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC(C(=O)CNC(=O)Cc2ccccn2)CC1 |
| InChI | InChI=1S/C19H27N3O4/c1-19(2,3)26-18(25)22-10-7-14(8-11-22)16(23)13-21-17(24)12-15-6-4-5-9-20-15/h4-6,9,14H,7-8,10-13H2,1-3H3,(H,21,24) |
| InChIKey | DTZQXPBVQYEWJC-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.44 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |