C16H22N2O3 — CID 93481126
tert-butyl (2S)-2-(2-pyridin-2-ylacetyl)pyrrolidine-1-carboxylate (PubChem CID 93481126) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl (2S)-2-(2-pyridin-2-ylacetyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-(2-pyridin-2-ylacetyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 93481126 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | tert-butyl (2S)-2-(2-pyridin-2-ylacetyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@H]1C(=O)Cc1ccccn1 |
| InChI | InChI=1S/C16H22N2O3/c1-16(2,3)21-15(20)18-10-6-8-13(18)14(19)11-12-7-4-5-9-17-12/h4-5,7,9,13H,6,8,10-11H2,1-3H3/t13-/m0/s1 |
| InChIKey | AHYFCPCFWXYHAQ-ZDUSSCGKSA-N |
| XLogP | 2.59 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |