C17H26N2O3 — CID 177219731
tert-butyl (2R)-2-(1-methoxy-1-pyridin-2-ylethyl)pyrrolidine-1-carboxylate (PubChem CID 177219731) has the molecular formula C17H26N2O3 and a molecular weight of 306.41 g/mol. Its IUPAC name is tert-butyl (2R)-2-(1-methoxy-1-pyridin-2-ylethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2R)-2-(1-methoxy-1-pyridin-2-ylethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 177219731 |
| Molecular Formula | C17H26N2O3 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.19 |
| IUPAC Name | tert-butyl (2R)-2-(1-methoxy-1-pyridin-2-ylethyl)pyrrolidine-1-carboxylate |
| SMILES | COC(C)(c1ccccn1)[C@H]1CCCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C17H26N2O3/c1-16(2,3)22-15(20)19-12-8-10-14(19)17(4,21-5)13-9-6-7-11-18-13/h6-7,9,11,14H,8,10,12H2,1-5H3/t14-,17?/m1/s1 |
| InChIKey | JCYYNNAQZPWQOA-XPCCGILXSA-N |
| XLogP | 3.34 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |