C14H16N4O4S2 — CID 122047696
5-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid (PubChem CID 122047696) has the molecular formula C14H16N4O4S2 and a molecular weight of 368.44 g/mol. Its IUPAC name is 5-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid.
| Compound Name | 5-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid |
|---|---|
| PubChem CID | 122047696 |
| Molecular Formula | C14H16N4O4S2 |
| Molecular Weight | 368.44 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | 5-[4-(thiophen-2-ylsulfonylamino)piperidin-1-yl]pyrazine-2-carboxylic acid |
| SMILES | O=C(O)c1cnc(N2CCC(NS(=O)(=O)c3cccs3)CC2)cn1 |
| InChI | InChI=1S/C14H16N4O4S2/c19-14(20)11-8-16-12(9-15-11)18-5-3-10(4-6-18)17-24(21,22)13-2-1-7-23-13/h1-2,7-10,17H,3-6H2,(H,19,20) |
| InChIKey | UZFMCVRVPWSAEU-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.44 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |