C13H15ClN4O2S2 — CID 51308992
N-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]thiophene-2-sulfonamide (PubChem CID 51308992) has the molecular formula C13H15ClN4O2S2 and a molecular weight of 358.88 g/mol. Its IUPAC name is N-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]thiophene-2-sulfonamide.
| Compound Name | N-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]thiophene-2-sulfonamide |
|---|---|
| PubChem CID | 51308992 |
| Molecular Formula | C13H15ClN4O2S2 |
| Molecular Weight | 358.88 g/mol |
| Exact Mass | 358.03 |
| IUPAC Name | N-[1-(6-chloropyrazin-2-yl)piperidin-4-yl]thiophene-2-sulfonamide |
| SMILES | O=S(=O)(NC1CCN(c2cncc(Cl)n2)CC1)c1cccs1 |
| InChI | InChI=1S/C13H15ClN4O2S2/c14-11-8-15-9-12(16-11)18-5-3-10(4-6-18)17-22(19,20)13-2-1-7-21-13/h1-2,7-10,17H,3-6H2 |
| InChIKey | PNFWSKJPLAXCCU-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.88 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |