C19H21N3O4S2 — CID 166343391
4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]cubane-1-carboxamide (PubChem CID 166343391) has the molecular formula C19H21N3O4S2 and a molecular weight of 419.53 g/mol. Its IUPAC name is 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]cubane-1-carboxamide.
| Compound Name | 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]cubane-1-carboxamide |
|---|---|
| PubChem CID | 166343391 |
| Molecular Formula | C19H21N3O4S2 |
| Molecular Weight | 419.53 g/mol |
| Exact Mass | 419.10 |
| IUPAC Name | 4-[4-(thiophen-2-ylsulfonylamino)piperidine-1-carbonyl]cubane-1-carboxamide |
| SMILES | NC(=O)C12C3C4C1C1C2C3C41C(=O)N1CCC(NS(=O)(=O)c2cccs2)CC1 |
| InChI | InChI=1S/C19H21N3O4S2/c20-16(23)18-10-13-11(18)15-12(18)14(10)19(13,15)17(24)22-5-3-8(4-6-22)21-28(25,26)9-2-1-7-27-9/h1-2,7-8,10-15,21H,3-6H2,(H2,20,23) |
| InChIKey | JJUGIWJFQFDCPV-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.53 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |