C15H18N4O4S — CID 71895342
4-[4-(methanesulfonamido)piperidin-1-yl]quinazoline-2-carboxylic acid (PubChem CID 71895342) has the molecular formula C15H18N4O4S and a molecular weight of 350.40 g/mol. Its IUPAC name is 4-[4-(methanesulfonamido)piperidin-1-yl]quinazoline-2-carboxylic acid.
| Compound Name | 4-[4-(methanesulfonamido)piperidin-1-yl]quinazoline-2-carboxylic acid |
|---|---|
| PubChem CID | 71895342 |
| Molecular Formula | C15H18N4O4S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 4-[4-(methanesulfonamido)piperidin-1-yl]quinazoline-2-carboxylic acid |
| SMILES | CS(=O)(=O)NC1CCN(c2nc(C(=O)O)nc3ccccc23)CC1 |
| InChI | InChI=1S/C15H18N4O4S/c1-24(22,23)18-10-6-8-19(9-7-10)14-11-4-2-3-5-12(11)16-13(17-14)15(20)21/h2-5,10,18H,6-9H2,1H3,(H,20,21) |
| InChIKey | IZKRANQYWDMHRG-UHFFFAOYSA-N |
| XLogP | 0.85 |
| TPSA | 112.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |