C16H18FN5O2 — CID 94818794
1-(4-fluorophenyl)-3-[(3S)-1-(4-methoxypyrimidin-2-yl)pyrrolidin-3-yl]urea (PubChem CID 94818794) has the molecular formula C16H18FN5O2 and a molecular weight of 331.35 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-3-[(3S)-1-(4-methoxypyrimidin-2-yl)pyrrolidin-3-yl]urea.
| Compound Name | 1-(4-fluorophenyl)-3-[(3S)-1-(4-methoxypyrimidin-2-yl)pyrrolidin-3-yl]urea |
|---|---|
| PubChem CID | 94818794 |
| Molecular Formula | C16H18FN5O2 |
| Molecular Weight | 331.35 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 1-(4-fluorophenyl)-3-[(3S)-1-(4-methoxypyrimidin-2-yl)pyrrolidin-3-yl]urea |
| SMILES | COc1ccnc(N2CC[C@H](NC(=O)Nc3ccc(F)cc3)C2)n1 |
| InChI | InChI=1S/C16H18FN5O2/c1-24-14-6-8-18-15(21-14)22-9-7-13(10-22)20-16(23)19-12-4-2-11(17)3-5-12/h2-6,8,13H,7,9-10H2,1H3,(H2,19,20,23)/t13-/m0/s1 |
| InChIKey | GOZPLJQMQCNICD-ZDUSSCGKSA-N |
| XLogP | 2.02 |
| TPSA | 79.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.35 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |