C17H20FN5O2 — CID 17448855
N-(4-fluorophenyl)-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]acetamide (PubChem CID 17448855) has the molecular formula C17H20FN5O2 and a molecular weight of 345.38 g/mol. Its IUPAC name is N-(4-fluorophenyl)-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]acetamide.
| Compound Name | N-(4-fluorophenyl)-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]acetamide |
|---|---|
| PubChem CID | 17448855 |
| Molecular Formula | C17H20FN5O2 |
| Molecular Weight | 345.38 g/mol |
| Exact Mass | 345.16 |
| IUPAC Name | N-(4-fluorophenyl)-2-[4-(4-methoxypyrimidin-2-yl)piperazin-1-yl]acetamide |
| SMILES | COc1ccnc(N2CCN(CC(=O)Nc3ccc(F)cc3)CC2)n1 |
| InChI | InChI=1S/C17H20FN5O2/c1-25-16-6-7-19-17(21-16)23-10-8-22(9-11-23)12-15(24)20-14-4-2-13(18)3-5-14/h2-7H,8-12H2,1H3,(H,20,24) |
| InChIKey | LYZZVXQURXMDLT-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.38 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |