C21H21F2N5O2 — CID 133475566
2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide (PubChem CID 133475566) has the molecular formula C21H21F2N5O2 and a molecular weight of 413.43 g/mol. Its IUPAC name is 2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide.
| Compound Name | 2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
|---|---|
| PubChem CID | 133475566 |
| Molecular Formula | C21H21F2N5O2 |
| Molecular Weight | 413.43 g/mol |
| Exact Mass | 413.17 |
| IUPAC Name | 2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-N-(4-fluorophenyl)acetamide |
| SMILES | COc1cc2c(N3CCN(CC(=O)Nc4ccc(F)cc4)CC3)ncnc2cc1F |
| InChI | InChI=1S/C21H21F2N5O2/c1-30-19-10-16-18(11-17(19)23)24-13-25-21(16)28-8-6-27(7-9-28)12-20(29)26-15-4-2-14(22)3-5-15/h2-5,10-11,13H,6-9,12H2,1H3,(H,26,29) |
| InChIKey | GIAYVJQWXDMSCW-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.43 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |