C20H26FN5O2 — CID 133475633
2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-1-piperidin-1-ylethanone (PubChem CID 133475633) has the molecular formula C20H26FN5O2 and a molecular weight of 387.46 g/mol. Its IUPAC name is 2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-1-piperidin-1-ylethanone.
| Compound Name | 2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-1-piperidin-1-ylethanone |
|---|---|
| PubChem CID | 133475633 |
| Molecular Formula | C20H26FN5O2 |
| Molecular Weight | 387.46 g/mol |
| Exact Mass | 387.21 |
| IUPAC Name | 2-[4-(7-fluoro-6-methoxyquinazolin-4-yl)piperazin-1-yl]-1-piperidin-1-ylethanone |
| SMILES | COc1cc2c(N3CCN(CC(=O)N4CCCCC4)CC3)ncnc2cc1F |
| InChI | InChI=1S/C20H26FN5O2/c1-28-18-11-15-17(12-16(18)21)22-14-23-20(15)26-9-7-24(8-10-26)13-19(27)25-5-3-2-4-6-25/h11-12,14H,2-10,13H2,1H3 |
| InChIKey | ZZLUHJPRKIXIAC-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 61.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.46 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |