C15H18N4O2S — CID 133273038
N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]thiophene-3-carboxamide (PubChem CID 133273038) has the molecular formula C15H18N4O2S and a molecular weight of 318.40 g/mol. Its IUPAC name is N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]thiophene-3-carboxamide.
| Compound Name | N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]thiophene-3-carboxamide |
|---|---|
| PubChem CID | 133273038 |
| Molecular Formula | C15H18N4O2S |
| Molecular Weight | 318.40 g/mol |
| Exact Mass | 318.12 |
| IUPAC Name | N-[1-(4-methoxypyrimidin-2-yl)piperidin-4-yl]thiophene-3-carboxamide |
| SMILES | COc1ccnc(N2CCC(NC(=O)c3ccsc3)CC2)n1 |
| InChI | InChI=1S/C15H18N4O2S/c1-21-13-2-6-16-15(18-13)19-7-3-12(4-8-19)17-14(20)11-5-9-22-10-11/h2,5-6,9-10,12H,3-4,7-8H2,1H3,(H,17,20) |
| InChIKey | AVNSRNCFHXFCCY-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 67.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.40 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |