C7H11N5O — CID 105439344
5-amino-N-cyclobutyl-2H-triazole-4-carboxamide (PubChem CID 105439344) has the molecular formula C7H11N5O and a molecular weight of 181.20 g/mol. Its IUPAC name is 5-amino-N-cyclobutyl-2H-triazole-4-carboxamide.
| Compound Name | 5-amino-N-cyclobutyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 105439344 |
| Molecular Formula | C7H11N5O |
| Molecular Weight | 181.20 g/mol |
| Exact Mass | 181.10 |
| IUPAC Name | 5-amino-N-cyclobutyl-2H-triazole-4-carboxamide |
| SMILES | Nc1n[nH]nc1C(=O)NC1CCC1 |
| InChI | InChI=1S/C7H11N5O/c8-6-5(10-12-11-6)7(13)9-4-2-1-3-4/h4H,1-3H2,(H,9,13)(H3,8,10,11,12) |
| InChIKey | ODICJTIOELHCLP-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 181.20 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |