C15H17FN4O — CID 166239999
N-(3-fluorocyclohexyl)-5-phenyl-2H-triazole-4-carboxamide (PubChem CID 166239999) has the molecular formula C15H17FN4O and a molecular weight of 288.33 g/mol. Its IUPAC name is N-(3-fluorocyclohexyl)-5-phenyl-2H-triazole-4-carboxamide.
| Compound Name | N-(3-fluorocyclohexyl)-5-phenyl-2H-triazole-4-carboxamide |
|---|---|
| PubChem CID | 166239999 |
| Molecular Formula | C15H17FN4O |
| Molecular Weight | 288.33 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | N-(3-fluorocyclohexyl)-5-phenyl-2H-triazole-4-carboxamide |
| SMILES | O=C(NC1CCCC(F)C1)c1n[nH]nc1-c1ccccc1 |
| InChI | InChI=1S/C15H17FN4O/c16-11-7-4-8-12(9-11)17-15(21)14-13(18-20-19-14)10-5-2-1-3-6-10/h1-3,5-6,11-12H,4,7-9H2,(H,17,21)(H,18,19,20) |
| InChIKey | BOBLMLYHQICXJH-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.33 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |