C9H14N4OS — CID 4623738
N-cyclohexyl-5-sulfanylidene-1,2-dihydrotriazole-4-carboxamide (PubChem CID 4623738) has the molecular formula C9H14N4OS and a molecular weight of 226.30 g/mol. Its IUPAC name is N-cyclohexyl-5-sulfanylidene-1,2-dihydrotriazole-4-carboxamide.
| Compound Name | N-cyclohexyl-5-sulfanylidene-1,2-dihydrotriazole-4-carboxamide |
|---|---|
| PubChem CID | 4623738 |
| Molecular Formula | C9H14N4OS |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.09 |
| IUPAC Name | N-cyclohexyl-5-sulfanylidene-1,2-dihydrotriazole-4-carboxamide |
| SMILES | O=C(NC1CCCCC1)c1n[nH][nH]c1=S |
| InChI | InChI=1S/C9H14N4OS/c14-8(7-9(15)12-13-11-7)10-6-4-2-1-3-5-6/h6H,1-5H2,(H,10,14)(H2,11,12,13,15) |
| InChIKey | JRUIEVUSJMRVMQ-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 73.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|