C9H15N5O — CID 62807330
3-amino-N-cyclohexyl-1H-1,2,4-triazole-5-carboxamide (PubChem CID 62807330) has the molecular formula C9H15N5O and a molecular weight of 209.25 g/mol. Its IUPAC name is 3-amino-N-cyclohexyl-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-cyclohexyl-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 62807330 |
| Molecular Formula | C9H15N5O |
| Molecular Weight | 209.25 g/mol |
| Exact Mass | 209.13 |
| IUPAC Name | 3-amino-N-cyclohexyl-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NC2CCCCC2)n1 |
| InChI | InChI=1S/C9H15N5O/c10-9-12-7(13-14-9)8(15)11-6-4-2-1-3-5-6/h6H,1-5H2,(H,11,15)(H3,10,12,13,14) |
| InChIKey | NMFRLFUSNATSFI-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |