C8H13N5O3S — CID 63923924
3-amino-N-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 63923924) has the molecular formula C8H13N5O3S and a molecular weight of 259.29 g/mol. Its IUPAC name is 3-amino-N-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 63923924 |
| Molecular Formula | C8H13N5O3S |
| Molecular Weight | 259.29 g/mol |
| Exact Mass | 259.07 |
| IUPAC Name | 3-amino-N-(1,1-dioxothian-3-yl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NC2CCCS(=O)(=O)C2)n1 |
| InChI | InChI=1S/C8H13N5O3S/c9-8-11-6(12-13-8)7(14)10-5-2-1-3-17(15,16)4-5/h5H,1-4H2,(H,10,14)(H3,9,11,12,13) |
| InChIKey | RPGPKYYXANUOKS-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 130.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.29 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |