C15H16ClN3O3S — CID 127319581
3-(4-chlorophenyl)-N-(1,1-dioxothian-3-yl)-1H-pyrazole-5-carboxamide (PubChem CID 127319581) has the molecular formula C15H16ClN3O3S and a molecular weight of 353.83 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-N-(1,1-dioxothian-3-yl)-1H-pyrazole-5-carboxamide.
| Compound Name | 3-(4-chlorophenyl)-N-(1,1-dioxothian-3-yl)-1H-pyrazole-5-carboxamide |
|---|---|
| PubChem CID | 127319581 |
| Molecular Formula | C15H16ClN3O3S |
| Molecular Weight | 353.83 g/mol |
| Exact Mass | 353.06 |
| IUPAC Name | 3-(4-chlorophenyl)-N-(1,1-dioxothian-3-yl)-1H-pyrazole-5-carboxamide |
| SMILES | O=C(NC1CCCS(=O)(=O)C1)c1cc(-c2ccc(Cl)cc2)n[nH]1 |
| InChI | InChI=1S/C15H16ClN3O3S/c16-11-5-3-10(4-6-11)13-8-14(19-18-13)15(20)17-12-2-1-7-23(21,22)9-12/h3-6,8,12H,1-2,7,9H2,(H,17,20)(H,18,19) |
| InChIKey | JRWXGXLBTBPSFV-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 91.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.83 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |