C15H15N3O4S — CID 110332099
N-(1,1-dioxothiolan-3-yl)-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide (PubChem CID 110332099) has the molecular formula C15H15N3O4S and a molecular weight of 333.37 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 110332099 |
| Molecular Formula | C15H15N3O4S |
| Molecular Weight | 333.37 g/mol |
| Exact Mass | 333.08 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-2-oxo-4-phenyl-1H-pyrimidine-6-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc(-c2ccccc2)nc(=O)[nH]1 |
| InChI | InChI=1S/C15H15N3O4S/c19-14(16-11-6-7-23(21,22)9-11)13-8-12(17-15(20)18-13)10-4-2-1-3-5-10/h1-5,8,11H,6-7,9H2,(H,16,19)(H,17,18,20) |
| InChIKey | CWPITICIHMPXMV-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 108.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.37 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |