C13H13FN2O3S — CID 110852734
N-(1,1-dioxothiolan-3-yl)-6-fluoro-1H-indole-2-carboxamide (PubChem CID 110852734) has the molecular formula C13H13FN2O3S and a molecular weight of 296.32 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-6-fluoro-1H-indole-2-carboxamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-6-fluoro-1H-indole-2-carboxamide |
|---|---|
| PubChem CID | 110852734 |
| Molecular Formula | C13H13FN2O3S |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-6-fluoro-1H-indole-2-carboxamide |
| SMILES | O=C(NC1CCS(=O)(=O)C1)c1cc2ccc(F)cc2[nH]1 |
| InChI | InChI=1S/C13H13FN2O3S/c14-9-2-1-8-5-12(16-11(8)6-9)13(17)15-10-3-4-20(18,19)7-10/h1-2,5-6,10,16H,3-4,7H2,(H,15,17) |
| InChIKey | AWZQKPHIYRXFOB-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 79.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |