C13H17ClN2O3S — CID 63917316
5-chloro-N-(1,1-dioxothian-3-yl)-2-(methylamino)benzamide (PubChem CID 63917316) has the molecular formula C13H17ClN2O3S and a molecular weight of 316.81 g/mol. Its IUPAC name is 5-chloro-N-(1,1-dioxothian-3-yl)-2-(methylamino)benzamide.
| Compound Name | 5-chloro-N-(1,1-dioxothian-3-yl)-2-(methylamino)benzamide |
|---|---|
| PubChem CID | 63917316 |
| Molecular Formula | C13H17ClN2O3S |
| Molecular Weight | 316.81 g/mol |
| Exact Mass | 316.06 |
| IUPAC Name | 5-chloro-N-(1,1-dioxothian-3-yl)-2-(methylamino)benzamide |
| SMILES | CNc1ccc(Cl)cc1C(=O)NC1CCCS(=O)(=O)C1 |
| InChI | InChI=1S/C13H17ClN2O3S/c1-15-12-5-4-9(14)7-11(12)13(17)16-10-3-2-6-20(18,19)8-10/h4-5,7,10,15H,2-3,6,8H2,1H3,(H,16,17) |
| InChIKey | OUXCVNUCKKLPOZ-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.81 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |