C10H17N5O2 — CID 113394753
3-amino-N-(2-hydroxycycloheptyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 113394753) has the molecular formula C10H17N5O2 and a molecular weight of 239.28 g/mol. Its IUPAC name is 3-amino-N-(2-hydroxycycloheptyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(2-hydroxycycloheptyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 113394753 |
| Molecular Formula | C10H17N5O2 |
| Molecular Weight | 239.28 g/mol |
| Exact Mass | 239.14 |
| IUPAC Name | 3-amino-N-(2-hydroxycycloheptyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | Nc1n[nH]c(C(=O)NC2CCCCCC2O)n1 |
| InChI | InChI=1S/C10H17N5O2/c11-10-13-8(14-15-10)9(17)12-6-4-2-1-3-5-7(6)16/h6-7,16H,1-5H2,(H,12,17)(H3,11,13,14,15) |
| InChIKey | YMMCLLBJKKLWBH-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 116.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |