C11H19N5O — CID 64748041
3-amino-N-(3-ethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide (PubChem CID 64748041) has the molecular formula C11H19N5O and a molecular weight of 237.31 g/mol. Its IUPAC name is 3-amino-N-(3-ethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide.
| Compound Name | 3-amino-N-(3-ethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide |
|---|---|
| PubChem CID | 64748041 |
| Molecular Formula | C11H19N5O |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.16 |
| IUPAC Name | 3-amino-N-(3-ethylcyclohexyl)-1H-1,2,4-triazole-5-carboxamide |
| SMILES | CCC1CCCC(NC(=O)c2nc(N)n[nH]2)C1 |
| InChI | InChI=1S/C11H19N5O/c1-2-7-4-3-5-8(6-7)13-10(17)9-14-11(12)16-15-9/h7-8H,2-6H2,1H3,(H,13,17)(H3,12,14,15,16) |
| InChIKey | XEPIPAINUVYSMB-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |